C13H7F2N3O4S — CID 5083433
N-(4,6-difluoro-3-methyl-1,3-benzothiazol-2-ylidene)-5-nitrofuran-2-carboxamide (PubChem CID 5083433) has the molecular formula C13H7F2N3O4S and a molecular weight of 339.28 g/mol. Its IUPAC name is N-(4,6-difluoro-3-methyl-1,3-benzothiazol-2-ylidene)-5-nitrofuran-2-carboxamide.
| Compound Name | N-(4,6-difluoro-3-methyl-1,3-benzothiazol-2-ylidene)-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 5083433 |
| Molecular Formula | C13H7F2N3O4S |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | N-(4,6-difluoro-3-methyl-1,3-benzothiazol-2-ylidene)-5-nitrofuran-2-carboxamide |
| SMILES | Cn1/c(=N/C(=O)c2ccc([N+](=O)[O-])o2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C13H7F2N3O4S/c1-17-11-7(15)4-6(14)5-9(11)23-13(17)16-12(19)8-2-3-10(22-8)18(20)21/h2-5H,1H3/b16-13- |
| InChIKey | ITGMPNAWXNBEAN-SSZFMOIBSA-N |
| XLogP | 2.76 |
| TPSA | 90.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|