C9H7N3O4S — CID 24687249
N-(3-methyl-1,3-thiazol-2-ylidene)-5-nitrofuran-2-carboxamide (PubChem CID 24687249) has the molecular formula C9H7N3O4S and a molecular weight of 253.24 g/mol. Its IUPAC name is N-(3-methyl-1,3-thiazol-2-ylidene)-5-nitrofuran-2-carboxamide.
| Compound Name | N-(3-methyl-1,3-thiazol-2-ylidene)-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 24687249 |
| Molecular Formula | C9H7N3O4S |
| Molecular Weight | 253.24 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | N-(3-methyl-1,3-thiazol-2-ylidene)-5-nitrofuran-2-carboxamide |
| SMILES | Cn1ccs/c1=N\C(=O)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C9H7N3O4S/c1-11-4-5-17-9(11)10-8(13)6-2-3-7(16-6)12(14)15/h2-5H,1H3/b10-9- |
| InChIKey | DCCKNHAUKSMADT-KTKRTIGZSA-N |
| XLogP | 1.33 |
| TPSA | 90.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|