C15H9N3O4S — CID 4146901
5-nitro-N-(3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)furan-2-carboxamide (PubChem CID 4146901) has the molecular formula C15H9N3O4S and a molecular weight of 327.32 g/mol. Its IUPAC name is 5-nitro-N-(3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)furan-2-carboxamide.
| Compound Name | 5-nitro-N-(3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)furan-2-carboxamide |
|---|---|
| PubChem CID | 4146901 |
| Molecular Formula | C15H9N3O4S |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 5-nitro-N-(3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)furan-2-carboxamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc([N+](=O)[O-])o2)sc2ccccc21 |
| InChI | InChI=1S/C15H9N3O4S/c1-2-9-17-10-5-3-4-6-12(10)23-15(17)16-14(19)11-7-8-13(22-11)18(20)21/h1,3-8H,9H2/b16-15- |
| InChIKey | VDQNEXYSGJJGAH-NXVVXOECSA-N |
| XLogP | 2.58 |
| TPSA | 90.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|