C14H8N4O4S — CID 41180005
N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-1,2-oxazole-5-carboxamide (PubChem CID 41180005) has the molecular formula C14H8N4O4S and a molecular weight of 328.31 g/mol. Its IUPAC name is N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-1,2-oxazole-5-carboxamide.
| Compound Name | N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 41180005 |
| Molecular Formula | C14H8N4O4S |
| Molecular Weight | 328.31 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | N-(6-nitro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-1,2-oxazole-5-carboxamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccno2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C14H8N4O4S/c1-2-7-17-10-4-3-9(18(20)21)8-12(10)23-14(17)16-13(19)11-5-6-15-22-11/h1,3-6,8H,7H2/b16-14- |
| InChIKey | OBZWNEQBCBVCHN-PEZBUJJGSA-N |
| XLogP | 1.97 |
| TPSA | 103.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|