C14H12N4O4S2 — CID 41180126
N-[3-(2-methylsulfanylethyl)-6-nitro-1,3-benzothiazol-2-ylidene]-1,2-oxazole-5-carboxamide (PubChem CID 41180126) has the molecular formula C14H12N4O4S2 and a molecular weight of 364.41 g/mol. Its IUPAC name is N-[3-(2-methylsulfanylethyl)-6-nitro-1,3-benzothiazol-2-ylidene]-1,2-oxazole-5-carboxamide.
| Compound Name | N-[3-(2-methylsulfanylethyl)-6-nitro-1,3-benzothiazol-2-ylidene]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 41180126 |
| Molecular Formula | C14H12N4O4S2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | N-[3-(2-methylsulfanylethyl)-6-nitro-1,3-benzothiazol-2-ylidene]-1,2-oxazole-5-carboxamide |
| SMILES | CSCCn1/c(=N/C(=O)c2ccno2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C14H12N4O4S2/c1-23-7-6-17-10-3-2-9(18(20)21)8-12(10)24-14(17)16-13(19)11-4-5-15-22-11/h2-5,8H,6-7H2,1H3/b16-14- |
| InChIKey | KLWMKWYFFXGZRH-PEZBUJJGSA-N |
| XLogP | 2.70 |
| TPSA | 103.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|