C21H19N3O3S3 — CID 30680386
N-[6-ethyl-3-(2-methylsulfanylethyl)-1,3-benzothiazol-2-ylidene]-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 30680386) has the molecular formula C21H19N3O3S3 and a molecular weight of 457.60 g/mol. Its IUPAC name is N-[6-ethyl-3-(2-methylsulfanylethyl)-1,3-benzothiazol-2-ylidene]-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[6-ethyl-3-(2-methylsulfanylethyl)-1,3-benzothiazol-2-ylidene]-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 30680386 |
| Molecular Formula | C21H19N3O3S3 |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | N-[6-ethyl-3-(2-methylsulfanylethyl)-1,3-benzothiazol-2-ylidene]-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | CCc1ccc2c(c1)s/c(=N\C(=O)c1cc3cc([N+](=O)[O-])ccc3s1)n2CCSC |
| InChI | InChI=1S/C21H19N3O3S3/c1-3-13-4-6-16-18(10-13)30-21(23(16)8-9-28-2)22-20(25)19-12-14-11-15(24(26)27)5-7-17(14)29-19/h4-7,10-12H,3,8-9H2,1-2H3/b22-21- |
| InChIKey | WVYVHGWVVJFIEW-DQRAZIAOSA-N |
| XLogP | 5.49 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|