C21H17N3O5S3 — CID 41126177
N-[3-(2-methylsulfanylethyl)-6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-ylidene]-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 41126177) has the molecular formula C21H17N3O5S3 and a molecular weight of 487.58 g/mol. Its IUPAC name is N-[3-(2-methylsulfanylethyl)-6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-ylidene]-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[3-(2-methylsulfanylethyl)-6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-ylidene]-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 41126177 |
| Molecular Formula | C21H17N3O5S3 |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.03 |
| IUPAC Name | N-[3-(2-methylsulfanylethyl)-6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-ylidene]-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | CSCCn1/c(=N/C(=O)c2cc3cc([N+](=O)[O-])ccc3s2)sc2cc3c(cc21)OCCO3 |
| InChI | InChI=1S/C21H17N3O5S3/c1-30-7-4-23-14-10-15-16(29-6-5-28-15)11-18(14)32-21(23)22-20(25)19-9-12-8-13(24(26)27)2-3-17(12)31-19/h2-3,8-11H,4-7H2,1H3/b22-21- |
| InChIKey | BOTUWQGKQQJOLN-DQRAZIAOSA-N |
| XLogP | 4.70 |
| TPSA | 95.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|