C18H14N4O7S — CID 42388269
N-(3-ethyl-6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-ylidene)-3,5-dinitrobenzamide (PubChem CID 42388269) has the molecular formula C18H14N4O7S and a molecular weight of 430.40 g/mol. Its IUPAC name is N-(3-ethyl-6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-ylidene)-3,5-dinitrobenzamide.
| Compound Name | N-(3-ethyl-6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-ylidene)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 42388269 |
| Molecular Formula | C18H14N4O7S |
| Molecular Weight | 430.40 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | N-(3-ethyl-6,7-dihydro-[1,4]dioxino[2,3-f][1,3]benzothiazol-2-ylidene)-3,5-dinitrobenzamide |
| SMILES | CCn1/c(=N/C(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)sc2cc3c(cc21)OCCO3 |
| InChI | InChI=1S/C18H14N4O7S/c1-2-20-13-8-14-15(29-4-3-28-14)9-16(13)30-18(20)19-17(23)10-5-11(21(24)25)7-12(6-10)22(26)27/h5-9H,2-4H2,1H3/b19-18- |
| InChIKey | MKEVEPXBMLOSPD-HNENSFHCSA-N |
| XLogP | 3.05 |
| TPSA | 139.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|