C16H13N3O6S2 — CID 41126046
N-[7-(2-methylsulfanylethyl)-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene]-5-nitrofuran-2-carboxamide (PubChem CID 41126046) has the molecular formula C16H13N3O6S2 and a molecular weight of 407.43 g/mol. Its IUPAC name is N-[7-(2-methylsulfanylethyl)-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene]-5-nitrofuran-2-carboxamide.
| Compound Name | N-[7-(2-methylsulfanylethyl)-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene]-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 41126046 |
| Molecular Formula | C16H13N3O6S2 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | N-[7-(2-methylsulfanylethyl)-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene]-5-nitrofuran-2-carboxamide |
| SMILES | CSCCn1/c(=N/C(=O)c2ccc([N+](=O)[O-])o2)sc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C16H13N3O6S2/c1-26-5-4-18-9-6-11-12(24-8-23-11)7-13(9)27-16(18)17-15(20)10-2-3-14(25-10)19(21)22/h2-3,6-7H,4-5,8H2,1H3/b17-16- |
| InChIKey | CXDJZIAFYMIMIU-MSUUIHNZSA-N |
| XLogP | 3.04 |
| TPSA | 109.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|