C18H13N3O4S — CID 4573875
N-(3-ethylbenzo[g][1,3]benzothiazol-2-ylidene)-5-nitrofuran-2-carboxamide (PubChem CID 4573875) has the molecular formula C18H13N3O4S and a molecular weight of 367.39 g/mol. Its IUPAC name is N-(3-ethylbenzo[g][1,3]benzothiazol-2-ylidene)-5-nitrofuran-2-carboxamide.
| Compound Name | N-(3-ethylbenzo[g][1,3]benzothiazol-2-ylidene)-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 4573875 |
| Molecular Formula | C18H13N3O4S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | N-(3-ethylbenzo[g][1,3]benzothiazol-2-ylidene)-5-nitrofuran-2-carboxamide |
| SMILES | CCn1/c(=N/C(=O)c2ccc([N+](=O)[O-])o2)sc2c3ccccc3ccc21 |
| InChI | InChI=1S/C18H13N3O4S/c1-2-20-13-8-7-11-5-3-4-6-12(11)16(13)26-18(20)19-17(22)14-9-10-15(25-14)21(23)24/h3-10H,2H2,1H3/b19-18- |
| InChIKey | TUUMSNWBDNJWGI-HNENSFHCSA-N |
| XLogP | 4.12 |
| TPSA | 90.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|