C26H20N2O2S — CID 4191270
N-(3-ethylbenzo[g][1,3]benzothiazol-2-ylidene)-3-phenoxybenzamide (PubChem CID 4191270) has the molecular formula C26H20N2O2S and a molecular weight of 424.53 g/mol. Its IUPAC name is N-(3-ethylbenzo[g][1,3]benzothiazol-2-ylidene)-3-phenoxybenzamide.
| Compound Name | N-(3-ethylbenzo[g][1,3]benzothiazol-2-ylidene)-3-phenoxybenzamide |
|---|---|
| PubChem CID | 4191270 |
| Molecular Formula | C26H20N2O2S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | N-(3-ethylbenzo[g][1,3]benzothiazol-2-ylidene)-3-phenoxybenzamide |
| SMILES | CCn1/c(=N/C(=O)c2cccc(Oc3ccccc3)c2)sc2c3ccccc3ccc21 |
| InChI | InChI=1S/C26H20N2O2S/c1-2-28-23-16-15-18-9-6-7-14-22(18)24(23)31-26(28)27-25(29)19-10-8-13-21(17-19)30-20-11-4-3-5-12-20/h3-17H,2H2,1H3/b27-26- |
| InChIKey | DNTJIHPHENRGSI-RQZHXJHFSA-N |
| XLogP | 6.41 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |