C22H18N2O3S — CID 41204527
methyl 2-[2-(3-methylbenzoyl)iminobenzo[g][1,3]benzothiazol-3-yl]acetate (PubChem CID 41204527) has the molecular formula C22H18N2O3S and a molecular weight of 390.46 g/mol. Its IUPAC name is methyl 2-[2-(3-methylbenzoyl)iminobenzo[g][1,3]benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[2-(3-methylbenzoyl)iminobenzo[g][1,3]benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 41204527 |
| Molecular Formula | C22H18N2O3S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | methyl 2-[2-(3-methylbenzoyl)iminobenzo[g][1,3]benzothiazol-3-yl]acetate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)c2cccc(C)c2)sc2c3ccccc3ccc21 |
| InChI | InChI=1S/C22H18N2O3S/c1-14-6-5-8-16(12-14)21(26)23-22-24(13-19(25)27-2)18-11-10-15-7-3-4-9-17(15)20(18)28-22/h3-12H,13H2,1-2H3/b23-22- |
| InChIKey | CAEJIIKRFRVOAO-FCQUAONHSA-N |
| XLogP | 4.08 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |