C26H21N3O5S — CID 41204039
ethyl 2-[2-[4-(2,5-dioxopyrrolidin-1-yl)benzoyl]iminobenzo[g][1,3]benzothiazol-3-yl]acetate (PubChem CID 41204039) has the molecular formula C26H21N3O5S and a molecular weight of 487.54 g/mol. Its IUPAC name is ethyl 2-[2-[4-(2,5-dioxopyrrolidin-1-yl)benzoyl]iminobenzo[g][1,3]benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-[4-(2,5-dioxopyrrolidin-1-yl)benzoyl]iminobenzo[g][1,3]benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 41204039 |
| Molecular Formula | C26H21N3O5S |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | ethyl 2-[2-[4-(2,5-dioxopyrrolidin-1-yl)benzoyl]iminobenzo[g][1,3]benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)c2ccc(N3C(=O)CCC3=O)cc2)sc2c3ccccc3ccc21 |
| InChI | InChI=1S/C26H21N3O5S/c1-2-34-23(32)15-28-20-12-9-16-5-3-4-6-19(16)24(20)35-26(28)27-25(33)17-7-10-18(11-8-17)29-21(30)13-14-22(29)31/h3-12H,2,13-15H2,1H3/b27-26- |
| InChIKey | ADJZKIWDTVAUSP-RQZHXJHFSA-N |
| XLogP | 3.81 |
| TPSA | 98.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|