C23H20N2O4S — CID 42387750
ethyl 2-[2-(2-methoxybenzoyl)iminobenzo[g][1,3]benzothiazol-3-yl]acetate (PubChem CID 42387750) has the molecular formula C23H20N2O4S and a molecular weight of 420.49 g/mol. Its IUPAC name is ethyl 2-[2-(2-methoxybenzoyl)iminobenzo[g][1,3]benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-(2-methoxybenzoyl)iminobenzo[g][1,3]benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 42387750 |
| Molecular Formula | C23H20N2O4S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | ethyl 2-[2-(2-methoxybenzoyl)iminobenzo[g][1,3]benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)c2ccccc2OC)sc2c3ccccc3ccc21 |
| InChI | InChI=1S/C23H20N2O4S/c1-3-29-20(26)14-25-18-13-12-15-8-4-5-9-16(15)21(18)30-23(25)24-22(27)17-10-6-7-11-19(17)28-2/h4-13H,3,14H2,1-2H3/b24-23- |
| InChIKey | ZJHNUHSEUNVHFM-VHXPQNKSSA-N |
| XLogP | 4.17 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |