C26H24N2O2S — CID 43946306
3-pentoxy-N-(3-prop-2-ynylbenzo[g][1,3]benzothiazol-2-ylidene)benzamide (PubChem CID 43946306) has the molecular formula C26H24N2O2S and a molecular weight of 428.56 g/mol. Its IUPAC name is 3-pentoxy-N-(3-prop-2-ynylbenzo[g][1,3]benzothiazol-2-ylidene)benzamide.
| Compound Name | 3-pentoxy-N-(3-prop-2-ynylbenzo[g][1,3]benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 43946306 |
| Molecular Formula | C26H24N2O2S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 3-pentoxy-N-(3-prop-2-ynylbenzo[g][1,3]benzothiazol-2-ylidene)benzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2cccc(OCCCCC)c2)sc2c3ccccc3ccc21 |
| InChI | InChI=1S/C26H24N2O2S/c1-3-5-8-17-30-21-12-9-11-20(18-21)25(29)27-26-28(16-4-2)23-15-14-19-10-6-7-13-22(19)24(23)31-26/h2,6-7,9-15,18H,3,5,8,16-17H2,1H3/b27-26- |
| InChIKey | YXOUQLCYSMDTJZ-RQZHXJHFSA-N |
| XLogP | 5.80 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|