C26H28N2O3S — CID 43939080
4-butoxy-N-[3-(2-ethoxyethyl)benzo[g][1,3]benzothiazol-2-ylidene]benzamide (PubChem CID 43939080) has the molecular formula C26H28N2O3S and a molecular weight of 448.59 g/mol. Its IUPAC name is 4-butoxy-N-[3-(2-ethoxyethyl)benzo[g][1,3]benzothiazol-2-ylidene]benzamide.
| Compound Name | 4-butoxy-N-[3-(2-ethoxyethyl)benzo[g][1,3]benzothiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 43939080 |
| Molecular Formula | C26H28N2O3S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 4-butoxy-N-[3-(2-ethoxyethyl)benzo[g][1,3]benzothiazol-2-ylidene]benzamide |
| SMILES | CCCCOc1ccc(C(=O)/N=c2\sc3c4ccccc4ccc3n2CCOCC)cc1 |
| InChI | InChI=1S/C26H28N2O3S/c1-3-5-17-31-21-13-10-20(11-14-21)25(29)27-26-28(16-18-30-4-2)23-15-12-19-8-6-7-9-22(19)24(23)32-26/h6-15H,3-5,16-18H2,1-2H3/b27-26- |
| InChIKey | BJXXHDMMJRBDDY-RQZHXJHFSA-N |
| XLogP | 5.81 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|