C18H13F2N3O5S — CID 4518504
ethyl 2-[4,6-difluoro-2-(4-nitrobenzoyl)imino-1,3-benzothiazol-3-yl]acetate (PubChem CID 4518504) has the molecular formula C18H13F2N3O5S and a molecular weight of 421.38 g/mol. Its IUPAC name is ethyl 2-[4,6-difluoro-2-(4-nitrobenzoyl)imino-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[4,6-difluoro-2-(4-nitrobenzoyl)imino-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 4518504 |
| Molecular Formula | C18H13F2N3O5S |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | ethyl 2-[4,6-difluoro-2-(4-nitrobenzoyl)imino-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)c2ccc([N+](=O)[O-])cc2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C18H13F2N3O5S/c1-2-28-15(24)9-22-16-13(20)7-11(19)8-14(16)29-18(22)21-17(25)10-3-5-12(6-4-10)23(26)27/h3-8H,2,9H2,1H3/b21-18- |
| InChIKey | IMYDFSQZOUZACC-UZYVYHOESA-N |
| XLogP | 3.19 |
| TPSA | 103.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|