C29H33N3O5S2 — CID 43939454
4-[benzyl(ethyl)sulfamoyl]-N-[4-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide (PubChem CID 43939454) has the molecular formula C29H33N3O5S2 and a molecular weight of 567.73 g/mol. Its IUPAC name is 4-[benzyl(ethyl)sulfamoyl]-N-[4-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide.
| Compound Name | 4-[benzyl(ethyl)sulfamoyl]-N-[4-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 43939454 |
| Molecular Formula | C29H33N3O5S2 |
| Molecular Weight | 567.73 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | 4-[benzyl(ethyl)sulfamoyl]-N-[4-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N(CC)Cc3ccccc3)cc2)sc2cccc(OCC)c21 |
| InChI | InChI=1S/C29H33N3O5S2/c1-4-31(21-22-11-8-7-9-12-22)39(34,35)24-17-15-23(16-18-24)28(33)30-29-32(19-20-36-5-2)27-25(37-6-3)13-10-14-26(27)38-29/h7-18H,4-6,19-21H2,1-3H3/b30-29- |
| InChIKey | CYGSJDUPXKQOMW-FLWNBWAVSA-N |
| XLogP | 5.09 |
| TPSA | 90.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.73 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|