C29H33N3O6S2 — CID 43979397
4-[benzyl(ethyl)sulfamoyl]-N-[3-(2-ethoxyethyl)-5,6-dimethoxy-1,3-benzothiazol-2-ylidene]benzamide (PubChem CID 43979397) has the molecular formula C29H33N3O6S2 and a molecular weight of 583.73 g/mol. Its IUPAC name is 4-[benzyl(ethyl)sulfamoyl]-N-[3-(2-ethoxyethyl)-5,6-dimethoxy-1,3-benzothiazol-2-ylidene]benzamide.
| Compound Name | 4-[benzyl(ethyl)sulfamoyl]-N-[3-(2-ethoxyethyl)-5,6-dimethoxy-1,3-benzothiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 43979397 |
| Molecular Formula | C29H33N3O6S2 |
| Molecular Weight | 583.73 g/mol |
| Exact Mass | 583.18 |
| IUPAC Name | 4-[benzyl(ethyl)sulfamoyl]-N-[3-(2-ethoxyethyl)-5,6-dimethoxy-1,3-benzothiazol-2-ylidene]benzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N(CC)Cc3ccccc3)cc2)sc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C29H33N3O6S2/c1-5-31(20-21-10-8-7-9-11-21)40(34,35)23-14-12-22(13-15-23)28(33)30-29-32(16-17-38-6-2)24-18-25(36-3)26(37-4)19-27(24)39-29/h7-15,18-19H,5-6,16-17,20H2,1-4H3/b30-29- |
| InChIKey | QIRWLYTWZHFLBJ-FLWNBWAVSA-N |
| XLogP | 4.71 |
| TPSA | 99.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.73 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|