C26H26ClN3O4S2 — CID 43939447
4-[benzyl(methyl)sulfamoyl]-N-[4-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide (PubChem CID 43939447) has the molecular formula C26H26ClN3O4S2 and a molecular weight of 544.10 g/mol. Its IUPAC name is 4-[benzyl(methyl)sulfamoyl]-N-[4-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide.
| Compound Name | 4-[benzyl(methyl)sulfamoyl]-N-[4-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 43939447 |
| Molecular Formula | C26H26ClN3O4S2 |
| Molecular Weight | 544.10 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | 4-[benzyl(methyl)sulfamoyl]-N-[4-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N(C)Cc3ccccc3)cc2)sc2cccc(Cl)c21 |
| InChI | InChI=1S/C26H26ClN3O4S2/c1-3-34-17-16-30-24-22(27)10-7-11-23(24)35-26(30)28-25(31)20-12-14-21(15-13-20)36(32,33)29(2)18-19-8-5-4-6-9-19/h4-15H,3,16-18H2,1-2H3/b28-26- |
| InChIKey | LWKRZXWRRMIXHT-SGEDCAFJSA-N |
| XLogP | 4.95 |
| TPSA | 80.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.10 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|