C19H17Cl2FN2O2S — CID 42524758
N-[4,7-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-(4-fluorophenyl)acetamide (PubChem CID 42524758) has the molecular formula C19H17Cl2FN2O2S and a molecular weight of 427.33 g/mol. Its IUPAC name is N-[4,7-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[4,7-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 42524758 |
| Molecular Formula | C19H17Cl2FN2O2S |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | N-[4,7-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-(4-fluorophenyl)acetamide |
| SMILES | CCOCCn1/c(=N/C(=O)Cc2ccc(F)cc2)sc2c(Cl)ccc(Cl)c21 |
| InChI | InChI=1S/C19H17Cl2FN2O2S/c1-2-26-10-9-24-17-14(20)7-8-15(21)18(17)27-19(24)23-16(25)11-12-3-5-13(22)6-4-12/h3-8H,2,9-11H2,1H3/b23-19- |
| InChIKey | GNCIOJXFWCITBM-NMWGTECJSA-N |
| XLogP | 4.86 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|