C21H23ClN2O4S2 — CID 42387905
3-(benzenesulfonyl)-N-[7-chloro-3-(2-ethoxyethyl)-4-methyl-1,3-benzothiazol-2-ylidene]propanamide (PubChem CID 42387905) has the molecular formula C21H23ClN2O4S2 and a molecular weight of 467.01 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-[7-chloro-3-(2-ethoxyethyl)-4-methyl-1,3-benzothiazol-2-ylidene]propanamide.
| Compound Name | 3-(benzenesulfonyl)-N-[7-chloro-3-(2-ethoxyethyl)-4-methyl-1,3-benzothiazol-2-ylidene]propanamide |
|---|---|
| PubChem CID | 42387905 |
| Molecular Formula | C21H23ClN2O4S2 |
| Molecular Weight | 467.01 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | 3-(benzenesulfonyl)-N-[7-chloro-3-(2-ethoxyethyl)-4-methyl-1,3-benzothiazol-2-ylidene]propanamide |
| SMILES | CCOCCn1/c(=N/C(=O)CCS(=O)(=O)c2ccccc2)sc2c(Cl)ccc(C)c21 |
| InChI | InChI=1S/C21H23ClN2O4S2/c1-3-28-13-12-24-19-15(2)9-10-17(22)20(19)29-21(24)23-18(25)11-14-30(26,27)16-7-5-4-6-8-16/h4-10H,3,11-14H2,1-2H3/b23-21- |
| InChIKey | VXNBPEIFBRDYAQ-LNVKXUELSA-N |
| XLogP | 3.99 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.01 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|