C22H26N2O4S2 — CID 42387908
3-(benzenesulfonyl)-N-[3-(2-ethoxyethyl)-4,7-dimethyl-1,3-benzothiazol-2-ylidene]propanamide (PubChem CID 42387908) has the molecular formula C22H26N2O4S2 and a molecular weight of 446.59 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-[3-(2-ethoxyethyl)-4,7-dimethyl-1,3-benzothiazol-2-ylidene]propanamide.
| Compound Name | 3-(benzenesulfonyl)-N-[3-(2-ethoxyethyl)-4,7-dimethyl-1,3-benzothiazol-2-ylidene]propanamide |
|---|---|
| PubChem CID | 42387908 |
| Molecular Formula | C22H26N2O4S2 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 3-(benzenesulfonyl)-N-[3-(2-ethoxyethyl)-4,7-dimethyl-1,3-benzothiazol-2-ylidene]propanamide |
| SMILES | CCOCCn1/c(=N/C(=O)CCS(=O)(=O)c2ccccc2)sc2c(C)ccc(C)c21 |
| InChI | InChI=1S/C22H26N2O4S2/c1-4-28-14-13-24-20-16(2)10-11-17(3)21(20)29-22(24)23-19(25)12-15-30(26,27)18-8-6-5-7-9-18/h5-11H,4,12-15H2,1-3H3/b23-22- |
| InChIKey | QYJDBSLLZSXYSD-FCQUAONHSA-N |
| XLogP | 3.65 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|