C20H18Cl2N2O2S — CID 30715588
N-(4,7-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(4-ethoxyphenyl)acetamide (PubChem CID 30715588) has the molecular formula C20H18Cl2N2O2S and a molecular weight of 421.35 g/mol. Its IUPAC name is N-(4,7-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(4-ethoxyphenyl)acetamide.
| Compound Name | N-(4,7-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 30715588 |
| Molecular Formula | C20H18Cl2N2O2S |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | N-(4,7-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(4-ethoxyphenyl)acetamide |
| SMILES | C=CCn1/c(=N/C(=O)Cc2ccc(OCC)cc2)sc2c(Cl)ccc(Cl)c21 |
| InChI | InChI=1S/C20H18Cl2N2O2S/c1-3-11-24-18-15(21)9-10-16(22)19(18)27-20(24)23-17(25)12-13-5-7-14(8-6-13)26-4-2/h3,5-10H,1,4,11-12H2,2H3/b23-20- |
| InChIKey | CMNBSPWHSDEMOT-ATJXCDBQSA-N |
| XLogP | 5.26 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|