C22H24N2O5S2 — CID 41126906
N-(4,7-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(4-ethylsulfonylphenyl)acetamide (PubChem CID 41126906) has the molecular formula C22H24N2O5S2 and a molecular weight of 460.58 g/mol. Its IUPAC name is N-(4,7-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(4-ethylsulfonylphenyl)acetamide.
| Compound Name | N-(4,7-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(4-ethylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 41126906 |
| Molecular Formula | C22H24N2O5S2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | N-(4,7-dimethoxy-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2-(4-ethylsulfonylphenyl)acetamide |
| SMILES | C=CCn1/c(=N/C(=O)Cc2ccc(S(=O)(=O)CC)cc2)sc2c(OC)ccc(OC)c21 |
| InChI | InChI=1S/C22H24N2O5S2/c1-5-13-24-20-17(28-3)11-12-18(29-4)21(20)30-22(24)23-19(25)14-15-7-9-16(10-8-15)31(26,27)6-2/h5,7-12H,1,6,13-14H2,2-4H3/b23-22- |
| InChIKey | UCGFRCLXTAUXIF-FCQUAONHSA-N |
| XLogP | 3.37 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|