C23H28N2O4S2 — CID 42525155
N-[3-(2-ethoxyethyl)-4,7-dimethoxy-1,3-benzothiazol-2-ylidene]-2-(4-ethylsulfanylphenyl)acetamide (PubChem CID 42525155) has the molecular formula C23H28N2O4S2 and a molecular weight of 460.62 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-4,7-dimethoxy-1,3-benzothiazol-2-ylidene]-2-(4-ethylsulfanylphenyl)acetamide.
| Compound Name | N-[3-(2-ethoxyethyl)-4,7-dimethoxy-1,3-benzothiazol-2-ylidene]-2-(4-ethylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 42525155 |
| Molecular Formula | C23H28N2O4S2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-4,7-dimethoxy-1,3-benzothiazol-2-ylidene]-2-(4-ethylsulfanylphenyl)acetamide |
| SMILES | CCOCCn1/c(=N/C(=O)Cc2ccc(SCC)cc2)sc2c(OC)ccc(OC)c21 |
| InChI | InChI=1S/C23H28N2O4S2/c1-5-29-14-13-25-21-18(27-3)11-12-19(28-4)22(21)31-23(25)24-20(26)15-16-7-9-17(10-8-16)30-6-2/h7-12H,5-6,13-15H2,1-4H3/b24-23- |
| InChIKey | QOQNCARRCSJWOP-VHXPQNKSSA-N |
| XLogP | 4.54 |
| TPSA | 62.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|