C20H20F2N2O2S2 — CID 25406071
N-[4,6-difluoro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-phenylsulfanylbutanamide (PubChem CID 25406071) has the molecular formula C20H20F2N2O2S2 and a molecular weight of 422.52 g/mol. Its IUPAC name is N-[4,6-difluoro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-phenylsulfanylbutanamide.
| Compound Name | N-[4,6-difluoro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-phenylsulfanylbutanamide |
|---|---|
| PubChem CID | 25406071 |
| Molecular Formula | C20H20F2N2O2S2 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | N-[4,6-difluoro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-phenylsulfanylbutanamide |
| SMILES | COCCn1/c(=N/C(=O)CCCSc2ccccc2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C20H20F2N2O2S2/c1-26-10-9-24-19-16(22)12-14(21)13-17(19)28-20(24)23-18(25)8-5-11-27-15-6-3-2-4-7-15/h2-4,6-7,12-13H,5,8-11H2,1H3/b23-20- |
| InChIKey | GWXYUUKJEMEBKH-ATJXCDBQSA-N |
| XLogP | 4.63 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|