C22H25FN2O2S — CID 41343045
N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]-2-(2,4,6-trimethylphenyl)acetamide (PubChem CID 41343045) has the molecular formula C22H25FN2O2S and a molecular weight of 400.52 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]-2-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]-2-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 41343045 |
| Molecular Formula | C22H25FN2O2S |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-4-fluoro-1,3-benzothiazol-2-ylidene]-2-(2,4,6-trimethylphenyl)acetamide |
| SMILES | CCOCCn1/c(=N/C(=O)Cc2c(C)cc(C)cc2C)sc2cccc(F)c21 |
| InChI | InChI=1S/C22H25FN2O2S/c1-5-27-10-9-25-21-18(23)7-6-8-19(21)28-22(25)24-20(26)13-17-15(3)11-14(2)12-16(17)4/h6-8,11-12H,5,9-10,13H2,1-4H3/b24-22- |
| InChIKey | NBDZCHFRNVLRTA-GYHWCHFESA-N |
| XLogP | 4.47 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|