C21H22N2O4S — CID 3629041
methyl 2-(3-butoxybenzoyl)imino-3-methyl-1,3-benzothiazole-6-carboxylate (PubChem CID 3629041) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is methyl 2-(3-butoxybenzoyl)imino-3-methyl-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-(3-butoxybenzoyl)imino-3-methyl-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 3629041 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | methyl 2-(3-butoxybenzoyl)imino-3-methyl-1,3-benzothiazole-6-carboxylate |
| SMILES | CCCCOc1cccc(C(=O)/N=c2\sc3cc(C(=O)OC)ccc3n2C)c1 |
| InChI | InChI=1S/C21H22N2O4S/c1-4-5-11-27-16-8-6-7-14(12-16)19(24)22-21-23(2)17-10-9-15(20(25)26-3)13-18(17)28-21/h6-10,12-13H,4-5,11H2,1-3H3/b22-21- |
| InChIKey | ZGNPAPBTCWCMFB-DQRAZIAOSA-N |
| XLogP | 3.95 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|