C24H29N3O4S2 — CID 41364152
4-[cyclopropyl(methyl)sulfamoyl]-N-[3-(2-ethoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-ylidene]benzamide (PubChem CID 41364152) has the molecular formula C24H29N3O4S2 and a molecular weight of 487.65 g/mol. Its IUPAC name is 4-[cyclopropyl(methyl)sulfamoyl]-N-[3-(2-ethoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-ylidene]benzamide.
| Compound Name | 4-[cyclopropyl(methyl)sulfamoyl]-N-[3-(2-ethoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 41364152 |
| Molecular Formula | C24H29N3O4S2 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 4-[cyclopropyl(methyl)sulfamoyl]-N-[3-(2-ethoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-ylidene]benzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N(C)C3CC3)cc2)sc2c(C)cc(C)cc21 |
| InChI | InChI=1S/C24H29N3O4S2/c1-5-31-13-12-27-21-15-16(2)14-17(3)22(21)32-24(27)25-23(28)18-6-10-20(11-7-18)33(29,30)26(4)19-8-9-19/h6-7,10-11,14-15,19H,5,8-9,12-13H2,1-4H3/b25-24- |
| InChIKey | UKTJYJHTYJATHX-IZHYLOQSSA-N |
| XLogP | 3.88 |
| TPSA | 80.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|