C19H14Cl2N2O3S — CID 43944209
N-(4,6-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 43944209) has the molecular formula C19H14Cl2N2O3S and a molecular weight of 421.31 g/mol. Its IUPAC name is N-(4,6-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-(4,6-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 43944209 |
| Molecular Formula | C19H14Cl2N2O3S |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | N-(4,6-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc3c(c2)OCCO3)sc2cc(Cl)cc(Cl)c21 |
| InChI | InChI=1S/C19H14Cl2N2O3S/c1-2-5-23-17-13(21)9-12(20)10-16(17)27-19(23)22-18(24)11-3-4-14-15(8-11)26-7-6-25-14/h2-4,8-10H,1,5-7H2/b22-19- |
| InChIKey | QKKRSBXDYCAGHW-QOCHGBHMSA-N |
| XLogP | 4.71 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|