C20H12Cl2N2O3S — CID 43944054
N-(4,6-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-oxochromene-2-carboxamide (PubChem CID 43944054) has the molecular formula C20H12Cl2N2O3S and a molecular weight of 431.30 g/mol. Its IUPAC name is N-(4,6-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-oxochromene-2-carboxamide.
| Compound Name | N-(4,6-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 43944054 |
| Molecular Formula | C20H12Cl2N2O3S |
| Molecular Weight | 431.30 g/mol |
| Exact Mass | 429.99 |
| IUPAC Name | N-(4,6-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-oxochromene-2-carboxamide |
| SMILES | C=CCn1/c(=N/C(=O)c2cc(=O)c3ccccc3o2)sc2cc(Cl)cc(Cl)c21 |
| InChI | InChI=1S/C20H12Cl2N2O3S/c1-2-7-24-18-13(22)8-11(21)9-17(18)28-20(24)23-19(26)16-10-14(25)12-5-3-4-6-15(12)27-16/h2-6,8-10H,1,7H2/b23-20- |
| InChIKey | ZSCCUPKJMGKLCQ-ATJXCDBQSA-N |
| XLogP | 5.04 |
| TPSA | 64.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.30 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|