C20H19ClN2O3S2 — CID 25407737
4-(4-chlorophenyl)sulfonyl-N-(3-prop-2-enyl-1,3-benzothiazol-2-ylidene)butanamide (PubChem CID 25407737) has the molecular formula C20H19ClN2O3S2 and a molecular weight of 434.97 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfonyl-N-(3-prop-2-enyl-1,3-benzothiazol-2-ylidene)butanamide.
| Compound Name | 4-(4-chlorophenyl)sulfonyl-N-(3-prop-2-enyl-1,3-benzothiazol-2-ylidene)butanamide |
|---|---|
| PubChem CID | 25407737 |
| Molecular Formula | C20H19ClN2O3S2 |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | 4-(4-chlorophenyl)sulfonyl-N-(3-prop-2-enyl-1,3-benzothiazol-2-ylidene)butanamide |
| SMILES | C=CCn1/c(=N/C(=O)CCCS(=O)(=O)c2ccc(Cl)cc2)sc2ccccc21 |
| InChI | InChI=1S/C20H19ClN2O3S2/c1-2-13-23-17-6-3-4-7-18(17)27-20(23)22-19(24)8-5-14-28(25,26)16-11-9-15(21)10-12-16/h2-4,6-7,9-12H,1,5,8,13-14H2/b22-20- |
| InChIKey | MQRAMABDMDRAQC-XDOYNYLZSA-N |
| XLogP | 4.22 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|