C19H19ClN2O3S2 — CID 25406819
4-(benzenesulfonyl)-N-(6-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)butanamide (PubChem CID 25406819) has the molecular formula C19H19ClN2O3S2 and a molecular weight of 422.96 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-N-(6-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)butanamide.
| Compound Name | 4-(benzenesulfonyl)-N-(6-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)butanamide |
|---|---|
| PubChem CID | 25406819 |
| Molecular Formula | C19H19ClN2O3S2 |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | 4-(benzenesulfonyl)-N-(6-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)butanamide |
| SMILES | CCn1/c(=N/C(=O)CCCS(=O)(=O)c2ccccc2)sc2cc(Cl)ccc21 |
| InChI | InChI=1S/C19H19ClN2O3S2/c1-2-22-16-11-10-14(20)13-17(16)26-19(22)21-18(23)9-6-12-27(24,25)15-7-4-3-5-8-15/h3-5,7-8,10-11,13H,2,6,9,12H2,1H3/b21-19- |
| InChIKey | CKTPMAKPHLKHKU-VZCXRCSSSA-N |
| XLogP | 4.06 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |