C28H32Cl2N4O2S2 — CID 4289489
N,N'-bis(6-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)decanediamide (PubChem CID 4289489) has the molecular formula C28H32Cl2N4O2S2 and a molecular weight of 591.63 g/mol. Its IUPAC name is N,N'-bis(6-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)decanediamide.
| Compound Name | N,N'-bis(6-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)decanediamide |
|---|---|
| PubChem CID | 4289489 |
| Molecular Formula | C28H32Cl2N4O2S2 |
| Molecular Weight | 591.63 g/mol |
| Exact Mass | 590.13 |
| IUPAC Name | N,N'-bis(6-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)decanediamide |
| SMILES | CCn1/c(=N/C(=O)CCCCCCCCC(=O)/N=c2\sc3cc(Cl)ccc3n2CC)sc2cc(Cl)ccc21 |
| InChI | InChI=1S/C28H32Cl2N4O2S2/c1-3-33-21-15-13-19(29)17-23(21)37-27(33)31-25(35)11-9-7-5-6-8-10-12-26(36)32-28-34(4-2)22-16-14-20(30)18-24(22)38-28/h13-18H,3-12H2,1-2H3/b31-27-,32-28- |
| InChIKey | QFZMLFHKZJXLMR-YDWWYXFJSA-N |
| XLogP | 7.74 |
| TPSA | 68.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.63 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|