C16H11Cl2N3O2S — CID 3339479
6-[(6-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)carbamoyl]pyridine-2-carbonyl chloride (PubChem CID 3339479) has the molecular formula C16H11Cl2N3O2S and a molecular weight of 380.26 g/mol. Its IUPAC name is 6-[(6-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)carbamoyl]pyridine-2-carbonyl chloride.
| Compound Name | 6-[(6-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)carbamoyl]pyridine-2-carbonyl chloride |
|---|---|
| PubChem CID | 3339479 |
| Molecular Formula | C16H11Cl2N3O2S |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | 6-[(6-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)carbamoyl]pyridine-2-carbonyl chloride |
| SMILES | CCn1/c(=N/C(=O)c2cccc(C(=O)Cl)n2)sc2cc(Cl)ccc21 |
| InChI | InChI=1S/C16H11Cl2N3O2S/c1-2-21-12-7-6-9(17)8-13(12)24-16(21)20-15(23)11-5-3-4-10(19-11)14(18)22/h3-8H,2H2,1H3/b20-16- |
| InChIKey | OAKPFUFEQZZQNL-SILNSSARSA-N |
| XLogP | 3.89 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|