C17H21ClN2O3S — CID 8612644
ethyl 3-(6-chloro-2-pentanoylimino-1,3-benzothiazol-3-yl)propanoate (PubChem CID 8612644) has the molecular formula C17H21ClN2O3S and a molecular weight of 368.89 g/mol. Its IUPAC name is ethyl 3-(6-chloro-2-pentanoylimino-1,3-benzothiazol-3-yl)propanoate.
| Compound Name | ethyl 3-(6-chloro-2-pentanoylimino-1,3-benzothiazol-3-yl)propanoate |
|---|---|
| PubChem CID | 8612644 |
| Molecular Formula | C17H21ClN2O3S |
| Molecular Weight | 368.89 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | ethyl 3-(6-chloro-2-pentanoylimino-1,3-benzothiazol-3-yl)propanoate |
| SMILES | CCCCC(=O)/N=c1\sc2cc(Cl)ccc2n1CCC(=O)OCC |
| InChI | InChI=1S/C17H21ClN2O3S/c1-3-5-6-15(21)19-17-20(10-9-16(22)23-4-2)13-8-7-12(18)11-14(13)24-17/h7-8,11H,3-6,9-10H2,1-2H3/b19-17- |
| InChIKey | NXXVOZAQCVSDCE-ZPHPHTNESA-N |
| XLogP | 3.93 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.89 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |