C15H14ClN3O4S — CID 7590268
N-(7-chloro-4-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-(2,5-dioxopyrrolidin-1-yl)acetamide (PubChem CID 7590268) has the molecular formula C15H14ClN3O4S and a molecular weight of 367.81 g/mol. Its IUPAC name is N-(7-chloro-4-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-(2,5-dioxopyrrolidin-1-yl)acetamide.
| Compound Name | N-(7-chloro-4-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-(2,5-dioxopyrrolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 7590268 |
| Molecular Formula | C15H14ClN3O4S |
| Molecular Weight | 367.81 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | N-(7-chloro-4-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-(2,5-dioxopyrrolidin-1-yl)acetamide |
| SMILES | COc1ccc(Cl)c2s/c(=N\C(=O)CN3C(=O)CCC3=O)n(C)c12 |
| InChI | InChI=1S/C15H14ClN3O4S/c1-18-13-9(23-2)4-3-8(16)14(13)24-15(18)17-10(20)7-19-11(21)5-6-12(19)22/h3-4H,5-7H2,1-2H3/b17-15- |
| InChIKey | NVQVPKBTLXZKJP-ICFOKQHNSA-N |
| XLogP | 1.48 |
| TPSA | 80.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.81 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|