C16H12N2O4S3 — CID 40892439
methyl 3-prop-2-ynyl-2-thiophen-2-ylsulfonylimino-1,3-benzothiazole-6-carboxylate (PubChem CID 40892439) has the molecular formula C16H12N2O4S3 and a molecular weight of 392.48 g/mol. Its IUPAC name is methyl 3-prop-2-ynyl-2-thiophen-2-ylsulfonylimino-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 3-prop-2-ynyl-2-thiophen-2-ylsulfonylimino-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 40892439 |
| Molecular Formula | C16H12N2O4S3 |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | methyl 3-prop-2-ynyl-2-thiophen-2-ylsulfonylimino-1,3-benzothiazole-6-carboxylate |
| SMILES | C#CCn1c(=NS(=O)(=O)c2cccs2)sc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C16H12N2O4S3/c1-3-8-18-12-7-6-11(15(19)22-2)10-13(12)24-16(18)17-25(20,21)14-5-4-9-23-14/h1,4-7,9-10H,8H2,2H3 |
| InChIKey | PVGFOXBDFOKYSF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|