C17H18N2O8S2 — CID 43953040
methyl 2-(2-acetylsulfonylacetyl)imino-3-(2-ethoxy-2-oxoethyl)-1,3-benzothiazole-6-carboxylate (PubChem CID 43953040) has the molecular formula C17H18N2O8S2 and a molecular weight of 442.47 g/mol. Its IUPAC name is methyl 2-(2-acetylsulfonylacetyl)imino-3-(2-ethoxy-2-oxoethyl)-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-(2-acetylsulfonylacetyl)imino-3-(2-ethoxy-2-oxoethyl)-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 43953040 |
| Molecular Formula | C17H18N2O8S2 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | methyl 2-(2-acetylsulfonylacetyl)imino-3-(2-ethoxy-2-oxoethyl)-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)CS(=O)(=O)C(C)=O)sc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C17H18N2O8S2/c1-4-27-15(22)8-19-12-6-5-11(16(23)26-3)7-13(12)28-17(19)18-14(21)9-29(24,25)10(2)20/h5-7H,4,8-9H2,1-3H3/b18-17- |
| InChIKey | UZLMWBUUDCDNSI-ZCXUNETKSA-N |
| XLogP | 0.44 |
| TPSA | 138.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|