C22H31N3O5S2 — CID 4607912
N-cyclohexyl-2-[2-[[3-(2-ethoxyethyl)-6-methyl-1,3-benzothiazol-2-ylidene]amino]-2-oxoethyl]sulfonylacetamide (PubChem CID 4607912) has the molecular formula C22H31N3O5S2 and a molecular weight of 481.64 g/mol. Its IUPAC name is N-cyclohexyl-2-[2-[[3-(2-ethoxyethyl)-6-methyl-1,3-benzothiazol-2-ylidene]amino]-2-oxoethyl]sulfonylacetamide.
| Compound Name | N-cyclohexyl-2-[2-[[3-(2-ethoxyethyl)-6-methyl-1,3-benzothiazol-2-ylidene]amino]-2-oxoethyl]sulfonylacetamide |
|---|---|
| PubChem CID | 4607912 |
| Molecular Formula | C22H31N3O5S2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | N-cyclohexyl-2-[2-[[3-(2-ethoxyethyl)-6-methyl-1,3-benzothiazol-2-ylidene]amino]-2-oxoethyl]sulfonylacetamide |
| SMILES | CCOCCn1/c(=N/C(=O)CS(=O)(=O)CC(=O)NC2CCCCC2)sc2cc(C)ccc21 |
| InChI | InChI=1S/C22H31N3O5S2/c1-3-30-12-11-25-18-10-9-16(2)13-19(18)31-22(25)24-21(27)15-32(28,29)14-20(26)23-17-7-5-4-6-8-17/h9-10,13,17H,3-8,11-12,14-15H2,1-2H3,(H,23,26)/b24-22- |
| InChIKey | GEMSCSLDVBBYST-GYHWCHFESA-N |
| XLogP | 2.34 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|