C22H25N3O6S2 — CID 3457409
methyl 2-[2-[2-(cyclohexylamino)-2-oxoethyl]sulfonylacetyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate (PubChem CID 3457409) has the molecular formula C22H25N3O6S2 and a molecular weight of 491.59 g/mol. Its IUPAC name is methyl 2-[2-[2-(cyclohexylamino)-2-oxoethyl]sulfonylacetyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-[2-[2-(cyclohexylamino)-2-oxoethyl]sulfonylacetyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 3457409 |
| Molecular Formula | C22H25N3O6S2 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | methyl 2-[2-[2-(cyclohexylamino)-2-oxoethyl]sulfonylacetyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate |
| SMILES | C#CCn1/c(=N/C(=O)CS(=O)(=O)CC(=O)NC2CCCCC2)sc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C22H25N3O6S2/c1-3-11-25-17-10-9-15(21(28)31-2)12-18(17)32-22(25)24-20(27)14-33(29,30)13-19(26)23-16-7-5-4-6-8-16/h1,9-10,12,16H,4-8,11,13-14H2,2H3,(H,23,26)/b24-22- |
| InChIKey | PUBDCUPILMKRKQ-GYHWCHFESA-N |
| XLogP | 1.41 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|