C20H21N3O7S2 — CID 4055613
methyl 2-[2-(2-morpholin-4-yl-2-oxoethyl)sulfonylacetyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate (PubChem CID 4055613) has the molecular formula C20H21N3O7S2 and a molecular weight of 479.54 g/mol. Its IUPAC name is methyl 2-[2-(2-morpholin-4-yl-2-oxoethyl)sulfonylacetyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-[2-(2-morpholin-4-yl-2-oxoethyl)sulfonylacetyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 4055613 |
| Molecular Formula | C20H21N3O7S2 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | methyl 2-[2-(2-morpholin-4-yl-2-oxoethyl)sulfonylacetyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate |
| SMILES | C#CCn1/c(=N/C(=O)CS(=O)(=O)CC(=O)N2CCOCC2)sc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C20H21N3O7S2/c1-3-6-23-15-5-4-14(19(26)29-2)11-16(15)31-20(23)21-17(24)12-32(27,28)13-18(25)22-7-9-30-10-8-22/h1,4-5,11H,6-10,12-13H2,2H3/b21-20- |
| InChIKey | XEJCPPFQEBUFSZ-MRCUWXFGSA-N |
| XLogP | -0.18 |
| TPSA | 124.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|