C22H23ClN2O3S — CID 3293378
3-(2-chlorophenyl)-N-[6-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]prop-2-enamide (PubChem CID 3293378) has the molecular formula C22H23ClN2O3S and a molecular weight of 430.96 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[6-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]prop-2-enamide.
| Compound Name | 3-(2-chlorophenyl)-N-[6-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]prop-2-enamide |
|---|---|
| PubChem CID | 3293378 |
| Molecular Formula | C22H23ClN2O3S |
| Molecular Weight | 430.96 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[6-ethoxy-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]prop-2-enamide |
| SMILES | CCOCCn1/c(=N/C(=O)C=Cc2ccccc2Cl)sc2cc(OCC)ccc21 |
| InChI | InChI=1S/C22H23ClN2O3S/c1-3-27-14-13-25-19-11-10-17(28-4-2)15-20(19)29-22(25)24-21(26)12-9-16-7-5-6-8-18(16)23/h5-12,15H,3-4,13-14H2,1-2H3/b12-9?,24-22- |
| InChIKey | ARVOKYGMJLYZMZ-XQSVVMJISA-N |
| XLogP | 4.93 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.96 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|