C18H15ClN2OS — CID 4655146
3-(2-chlorophenyl)-N-(3,6-dimethyl-1,3-benzothiazol-2-ylidene)prop-2-enamide (PubChem CID 4655146) has the molecular formula C18H15ClN2OS and a molecular weight of 342.85 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-(3,6-dimethyl-1,3-benzothiazol-2-ylidene)prop-2-enamide.
| Compound Name | 3-(2-chlorophenyl)-N-(3,6-dimethyl-1,3-benzothiazol-2-ylidene)prop-2-enamide |
|---|---|
| PubChem CID | 4655146 |
| Molecular Formula | C18H15ClN2OS |
| Molecular Weight | 342.85 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 3-(2-chlorophenyl)-N-(3,6-dimethyl-1,3-benzothiazol-2-ylidene)prop-2-enamide |
| SMILES | Cc1ccc2c(c1)s/c(=N\C(=O)C=Cc1ccccc1Cl)n2C |
| InChI | InChI=1S/C18H15ClN2OS/c1-12-7-9-15-16(11-12)23-18(21(15)2)20-17(22)10-8-13-5-3-4-6-14(13)19/h3-11H,1-2H3/b10-8?,20-18- |
| InChIKey | MBXOKGHALXSDSY-IBXYZHQYSA-N |
| XLogP | 4.34 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.85 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|