C20H19ClN2O3S3 — CID 74748209
3-(2-chlorophenyl)-N-[3-(2-methylsulfanylethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]prop-2-enamide (PubChem CID 74748209) has the molecular formula C20H19ClN2O3S3 and a molecular weight of 467.04 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[3-(2-methylsulfanylethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]prop-2-enamide.
| Compound Name | 3-(2-chlorophenyl)-N-[3-(2-methylsulfanylethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]prop-2-enamide |
|---|---|
| PubChem CID | 74748209 |
| Molecular Formula | C20H19ClN2O3S3 |
| Molecular Weight | 467.04 g/mol |
| Exact Mass | 466.02 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[3-(2-methylsulfanylethyl)-6-methylsulfonyl-1,3-benzothiazol-2-ylidene]prop-2-enamide |
| SMILES | CSCCn1/c(=N/C(=O)C=Cc2ccccc2Cl)sc2cc(S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C20H19ClN2O3S3/c1-27-12-11-23-17-9-8-15(29(2,25)26)13-18(17)28-20(23)22-19(24)10-7-14-5-3-4-6-16(14)21/h3-10,13H,11-12H2,1-2H3/b10-7?,22-20- |
| InChIKey | XZOLGVFRFFICEX-NKZICBIHSA-N |
| XLogP | 4.26 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.04 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|