C20H19ClN2O3S — CID 40886645
(E)-3-(2-chlorophenyl)-N-[4-methoxy-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]prop-2-enamide (PubChem CID 40886645) has the molecular formula C20H19ClN2O3S and a molecular weight of 402.90 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[4-methoxy-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[4-methoxy-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]prop-2-enamide |
|---|---|
| PubChem CID | 40886645 |
| Molecular Formula | C20H19ClN2O3S |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[4-methoxy-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]prop-2-enamide |
| SMILES | COCCn1/c(=N/C(=O)/C=C/c2ccccc2Cl)sc2cccc(OC)c21 |
| InChI | InChI=1S/C20H19ClN2O3S/c1-25-13-12-23-19-16(26-2)8-5-9-17(19)27-20(23)22-18(24)11-10-14-6-3-4-7-15(14)21/h3-11H,12-13H2,1-2H3/b11-10+,22-20- |
| InChIKey | JKLMMOBTKVNXIT-IJUZOVILSA-N |
| XLogP | 4.15 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|