C19H12Cl2N2OS — CID 43946118
(E)-N-(4,6-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-phenylprop-2-enamide (PubChem CID 43946118) has the molecular formula C19H12Cl2N2OS and a molecular weight of 387.29 g/mol. Its IUPAC name is (E)-N-(4,6-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-phenylprop-2-enamide.
| Compound Name | (E)-N-(4,6-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 43946118 |
| Molecular Formula | C19H12Cl2N2OS |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 386.00 |
| IUPAC Name | (E)-N-(4,6-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-phenylprop-2-enamide |
| SMILES | C#CCn1/c(=N/C(=O)/C=C/c2ccccc2)sc2cc(Cl)cc(Cl)c21 |
| InChI | InChI=1S/C19H12Cl2N2OS/c1-2-10-23-18-15(21)11-14(20)12-16(18)25-19(23)22-17(24)9-8-13-6-4-3-5-7-13/h1,3-9,11-12H,10H2/b9-8+,22-19- |
| InChIKey | ZBGXJWMIHBGYIZ-KWVVERJVSA-N |
| XLogP | 4.78 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|