C23H21Cl2N3O3S2 — CID 43946147
4-(azepan-1-ylsulfonyl)-N-(4,6-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 43946147) has the molecular formula C23H21Cl2N3O3S2 and a molecular weight of 522.48 g/mol. Its IUPAC name is 4-(azepan-1-ylsulfonyl)-N-(4,6-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-(azepan-1-ylsulfonyl)-N-(4,6-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 43946147 |
| Molecular Formula | C23H21Cl2N3O3S2 |
| Molecular Weight | 522.48 g/mol |
| Exact Mass | 521.04 |
| IUPAC Name | 4-(azepan-1-ylsulfonyl)-N-(4,6-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N3CCCCCC3)cc2)sc2cc(Cl)cc(Cl)c21 |
| InChI | InChI=1S/C23H21Cl2N3O3S2/c1-2-11-28-21-19(25)14-17(24)15-20(21)32-23(28)26-22(29)16-7-9-18(10-8-16)33(30,31)27-12-5-3-4-6-13-27/h1,7-10,14-15H,3-6,11-13H2/b26-23- |
| InChIKey | GABJGLQWVWDRGY-RWEWTDSWSA-N |
| XLogP | 4.95 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|