C24H23Cl2N3O3S2 — CID 43946233
N-(4,6-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 43946233) has the molecular formula C24H23Cl2N3O3S2 and a molecular weight of 536.51 g/mol. Its IUPAC name is N-(4,6-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-(4,6-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 43946233 |
| Molecular Formula | C24H23Cl2N3O3S2 |
| Molecular Weight | 536.51 g/mol |
| Exact Mass | 535.06 |
| IUPAC Name | N-(4,6-dichloro-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N3CC(C)CC(C)C3)cc2)sc2cc(Cl)cc(Cl)c21 |
| InChI | InChI=1S/C24H23Cl2N3O3S2/c1-4-9-29-22-20(26)11-18(25)12-21(22)33-24(29)27-23(30)17-5-7-19(8-6-17)34(31,32)28-13-15(2)10-16(3)14-28/h1,5-8,11-12,15-16H,9-10,13-14H2,2-3H3/b27-24- |
| InChIKey | MDDJSILEPLWHFW-PNHLSOANSA-N |
| XLogP | 5.05 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|